In this work, based on mixed N-, O-donor ligands, a series of Co(ii)-Dy(iii) compounds are synthesised and characterised by single crystal X-ray diffraction and magnetic studies. These compounds include Co2(phen)2Dy(PhCOO)7 (1), Co2(phen)2Dy2(PhCOO)10 (2), Co(bpy)Dy(H2O)(CH3-PhCOO)5 (3), Co(phen)Dy(H2O)(CH3-PhCOO)5 (4), Co2(phen)2Dy(NO2-PhCOO)7 (5), Co2(phen)2Dy2(NO2-PhCOO)10 (6), and Co2(bpy)2Dy2(NO2-PhCOO)10 (7), where phen, bpy, CH3-PhCOOH, and NO2-PhCOOH are 1,10-phenanthroline, 2,2′-bipyridine, 3-methylbenzoic acid, and 3-nitrobenzoic acid, respectively. In these cases, di-, tri-, and tetranuclear Co-Dy clusters are observed. Direct current (DC) magnetic susceptibility reveals ferromagnetic or antiferromagnetic behaviour, whilst dynamic magnetic studies disclose single molecule magnet (SMM)-like slow magnetic relaxation for most of these compounds.